C23H26N3O3S2+ — CID 2655781
N-benzhydryl-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide (PubChem CID 2655781) has the molecular formula C23H26N3O3S2+ and a molecular weight of 456.61 g/mol. Its IUPAC name is N-benzhydryl-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-benzhydryl-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 2655781 |
| Molecular Formula | C23H26N3O3S2+ |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-benzhydryl-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2cccs2)CC1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O3S2/c27-21(24-23(19-8-3-1-4-9-19)20-10-5-2-6-11-20)18-25-13-15-26(16-14-25)31(28,29)22-12-7-17-30-22/h1-12,17,23H,13-16,18H2,(H,24,27)/p+1 |
| InChIKey | JRQDTLIRQRLNMY-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |