C15H20N3O4S2+ — CID 8745661
N-(furan-2-ylmethyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8745661) has the molecular formula C15H20N3O4S2+ and a molecular weight of 370.48 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8745661 |
| Molecular Formula | C15H20N3O4S2+ |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2cccs2)CC1)NCc1ccco1 |
| InChI | InChI=1S/C15H19N3O4S2/c19-14(16-11-13-3-1-9-22-13)12-17-5-7-18(8-6-17)24(20,21)15-4-2-10-23-15/h1-4,9-10H,5-8,11-12H2,(H,16,19)/p+1 |
| InChIKey | NPAUUQBCNIJTSE-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |