C15H17N4O3S3+ — CID 8745941
N-(3-cyanothiophen-2-yl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8745941) has the molecular formula C15H17N4O3S3+ and a molecular weight of 397.53 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8745941 |
| Molecular Formula | C15H17N4O3S3+ |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)acetamide |
| SMILES | N#Cc1ccsc1NC(=O)C[NH+]1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C15H16N4O3S3/c16-10-12-3-9-24-15(12)17-13(20)11-18-4-6-19(7-5-18)25(21,22)14-2-1-8-23-14/h1-3,8-9H,4-7,11H2,(H,17,20)/p+1 |
| InChIKey | ZOGKYFHUIOMWMF-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |