C18H21N4O2S+ — CID 2402942
N-(3-cyanothiophen-2-yl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 2402942) has the molecular formula C18H21N4O2S+ and a molecular weight of 357.46 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2402942 |
| Molecular Formula | C18H21N4O2S+ |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccccc1N1CC[NH+](CC(=O)Nc2sccc2C#N)CC1 |
| InChI | InChI=1S/C18H20N4O2S/c1-24-16-5-3-2-4-15(16)22-9-7-21(8-10-22)13-17(23)20-18-14(12-19)6-11-25-18/h2-6,11H,7-10,13H2,1H3,(H,20,23)/p+1 |
| InChIKey | OZZJWVMJOHLEDG-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |