C19H20ClN4O3S+ — CID 9391502
2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(4-cyanophenyl)acetamide (PubChem CID 9391502) has the molecular formula C19H20ClN4O3S+ and a molecular weight of 419.91 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(4-cyanophenyl)acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 9391502 |
| Molecular Formula | C19H20ClN4O3S+ |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(4-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)C[NH+]2CCN(S(=O)(=O)c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C19H19ClN4O3S/c20-17-3-1-2-4-18(17)28(26,27)24-11-9-23(10-12-24)14-19(25)22-16-7-5-15(13-21)6-8-16/h1-8H,9-12,14H2,(H,22,25)/p+1 |
| InChIKey | NNCDSASEWILYIJ-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |