C19H31ClN3O3S+ — CID 8694004
2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(2S)-5-methylhexan-2-yl]acetamide (PubChem CID 8694004) has the molecular formula C19H31ClN3O3S+ and a molecular weight of 417.00 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(2S)-5-methylhexan-2-yl]acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(2S)-5-methylhexan-2-yl]acetamide |
|---|---|
| PubChem CID | 8694004 |
| Molecular Formula | C19H31ClN3O3S+ |
| Molecular Weight | 417.00 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(2S)-5-methylhexan-2-yl]acetamide |
| SMILES | CC(C)CC[C@H](C)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H30ClN3O3S/c1-15(2)8-9-16(3)21-19(24)14-22-10-12-23(13-11-22)27(25,26)18-7-5-4-6-17(18)20/h4-7,15-16H,8-14H2,1-3H3,(H,21,24)/p+1/t16-/m0/s1 |
| InChIKey | FHCJHPFIYZZWHD-INIZCTEOSA-O |
| XLogP | 1.17 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.00 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |