C20H25ClN3O3S+ — CID 9391477
2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 9391477) has the molecular formula C20H25ClN3O3S+ and a molecular weight of 422.96 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 9391477 |
| Molecular Formula | C20H25ClN3O3S+ |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)C[NH+]2CCN(S(=O)(=O)c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H24ClN3O3S/c1-2-16-7-9-17(10-8-16)22-20(25)15-23-11-13-24(14-12-23)28(26,27)19-6-4-3-5-18(19)21/h3-10H,2,11-15H2,1H3,(H,22,25)/p+1 |
| InChIKey | ORSCUWYTEXUQNZ-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |