C19H20ClN4O+ — CID 8528279
2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-cyanophenyl)acetamide (PubChem CID 8528279) has the molecular formula C19H20ClN4O+ and a molecular weight of 355.85 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-cyanophenyl)acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 8528279 |
| Molecular Formula | C19H20ClN4O+ |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)C[NH+]2CCN(c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C19H19ClN4O/c20-17-3-1-2-4-18(17)24-11-9-23(10-12-24)14-19(25)22-16-7-5-15(13-21)6-8-16/h1-8H,9-12,14H2,(H,22,25)/p+1 |
| InChIKey | CXKSPNVIXSICHG-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 60.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |