C23H24ClF2N3O2 — CID 69148594
3-(3-chloro-4-methylphenyl)-3-[5-(2,3-difluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide (PubChem CID 69148594) has the molecular formula C23H24ClF2N3O2 and a molecular weight of 447.91 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-3-[5-(2,3-difluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-3-[5-(2,3-difluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 69148594 |
| Molecular Formula | C23H24ClF2N3O2 |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-3-[5-(2,3-difluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propanamide |
| SMILES | Cc1ccc(C(CC(N)=O)N2CC3CN(C(=O)c4cccc(F)c4F)CC3C2)cc1Cl |
| InChI | InChI=1S/C23H24ClF2N3O2/c1-13-5-6-14(7-18(13)24)20(8-21(27)30)28-9-15-11-29(12-16(15)10-28)23(31)17-3-2-4-19(25)22(17)26/h2-7,15-16,20H,8-12H2,1H3,(H2,27,30) |
| InChIKey | NNNNZJSDZHETTD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |