C25H31ClN4O3 — CID 69150641
N-(3-chloro-4-methylphenyl)-3-[5-(2,4-dimethyl-6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]butanamide (PubChem CID 69150641) has the molecular formula C25H31ClN4O3 and a molecular weight of 471.00 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-[5-(2,4-dimethyl-6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]butanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-[5-(2,4-dimethyl-6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]butanamide |
|---|---|
| PubChem CID | 69150641 |
| Molecular Formula | C25H31ClN4O3 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-[5-(2,4-dimethyl-6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]butanamide |
| SMILES | Cc1ccc(NC(=O)CC(C)N2CC3CN(C(=O)c4c(C)cc(=O)[nH]c4C)CC3C2)cc1Cl |
| InChI | InChI=1S/C25H31ClN4O3/c1-14-5-6-20(9-21(14)26)28-23(32)8-16(3)29-10-18-12-30(13-19(18)11-29)25(33)24-15(2)7-22(31)27-17(24)4/h5-7,9,16,18-19H,8,10-13H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | HHAJNDAFLOCMKE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |