C16H22ClN3O2 — CID 75427835
N-(3-chloro-4-methylphenyl)-3-[(2-oxopiperidin-3-yl)amino]butanamide (PubChem CID 75427835) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-[(2-oxopiperidin-3-yl)amino]butanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-[(2-oxopiperidin-3-yl)amino]butanamide |
|---|---|
| PubChem CID | 75427835 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-[(2-oxopiperidin-3-yl)amino]butanamide |
| SMILES | Cc1ccc(NC(=O)CC(C)NC2CCCNC2=O)cc1Cl |
| InChI | InChI=1S/C16H22ClN3O2/c1-10-5-6-12(9-13(10)17)20-15(21)8-11(2)19-14-4-3-7-18-16(14)22/h5-6,9,11,14,19H,3-4,7-8H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | LFBMXAPLTSYGOI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |