C13H15ClN2O2 — CID 110682147
N-(3-chloro-4-methylphenyl)-2-oxopiperidine-4-carboxamide (PubChem CID 110682147) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-oxopiperidine-4-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-oxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 110682147 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-oxopiperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCNC(=O)C2)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O2/c1-8-2-3-10(7-11(8)14)16-13(18)9-4-5-15-12(17)6-9/h2-3,7,9H,4-6H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | QCEXDFBCQACDNN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |