C31H34ClF2N5O2 — CID 69146978
1-(3-chloro-4-methylphenyl)-3-(3,4-difluorophenyl)-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea (PubChem CID 69146978) has the molecular formula C31H34ClF2N5O2 and a molecular weight of 582.10 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(3,4-difluorophenyl)-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(3,4-difluorophenyl)-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea |
|---|---|
| PubChem CID | 69146978 |
| Molecular Formula | C31H34ClF2N5O2 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(3,4-difluorophenyl)-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea |
| SMILES | Cc1ccc(N(CCCN2CC3CN(C(=O)c4c(C)ccnc4C)CC3C2)C(=O)Nc2ccc(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C31H34ClF2N5O2/c1-19-5-7-25(14-26(19)32)39(31(41)36-24-6-8-27(33)28(34)13-24)12-4-11-37-15-22-17-38(18-23(22)16-37)30(40)29-20(2)9-10-35-21(29)3/h5-10,13-14,22-23H,4,11-12,15-18H2,1-3H3,(H,36,41) |
| InChIKey | HNAAHAFRRSTRJA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |