C31H33Cl2N5O2 — CID 69147045
1-(3-chloro-4-methylphenyl)-3-(3-chlorophenyl)-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea (PubChem CID 69147045) has the molecular formula C31H33Cl2N5O2 and a molecular weight of 578.54 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(3-chlorophenyl)-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(3-chlorophenyl)-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea |
|---|---|
| PubChem CID | 69147045 |
| Molecular Formula | C31H33Cl2N5O2 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(3-chlorophenyl)-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea |
| SMILES | Cc1ccc(N(CCCN2CC3=CN(C(=O)c4c(C)ccnc4C)CC3C2)C(=O)Nc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C31H33Cl2N5O2/c1-20-8-9-27(15-28(20)33)38(31(40)35-26-7-4-6-25(32)14-26)13-5-12-36-16-23-18-37(19-24(23)17-36)30(39)29-21(2)10-11-34-22(29)3/h4,6-11,14-15,18,24H,5,12-13,16-17,19H2,1-3H3,(H,35,40) |
| InChIKey | SMJONPUIYPVATN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |