C32H34Cl3N5O2 — CID 69146854
1-(3-chloro-4-methylphenyl)-3-[(3,4-dichlorophenyl)methyl]-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea (PubChem CID 69146854) has the molecular formula C32H34Cl3N5O2 and a molecular weight of 627.02 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[(3,4-dichlorophenyl)methyl]-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[(3,4-dichlorophenyl)methyl]-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea |
|---|---|
| PubChem CID | 69146854 |
| Molecular Formula | C32H34Cl3N5O2 |
| Molecular Weight | 627.02 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[(3,4-dichlorophenyl)methyl]-1-[3-[5-(2,4-dimethylpyridine-3-carbonyl)-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]propyl]urea |
| SMILES | Cc1ccc(N(CCCN2CC3=CN(C(=O)c4c(C)ccnc4C)CC3C2)C(=O)NCc2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C32H34Cl3N5O2/c1-20-5-7-26(14-28(20)34)40(32(42)37-15-23-6-8-27(33)29(35)13-23)12-4-11-38-16-24-18-39(19-25(24)17-38)31(41)30-21(2)9-10-36-22(30)3/h5-10,13-14,18,25H,4,11-12,15-17,19H2,1-3H3,(H,37,42) |
| InChIKey | JDXABXYANDDDOV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.02 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |