C26H32N2O3 — CID 42482748
1-[(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(4-acetylphenoxy)ethanone (PubChem CID 42482748) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(4-acetylphenoxy)ethanone.
| Compound Name | 1-[(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(4-acetylphenoxy)ethanone |
|---|---|
| PubChem CID | 42482748 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-[(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(4-acetylphenoxy)ethanone |
| SMILES | CC(=O)c1ccc(OCC(=O)N2CCC[C@@H]3CN(CCc4ccccc4)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C26H32N2O3/c1-20(29)22-9-11-24(12-10-22)31-19-26(30)28-15-5-8-23-18-27(17-14-25(23)28)16-13-21-6-3-2-4-7-21/h2-4,6-7,9-12,23,25H,5,8,13-19H2,1H3/t23-,25+/m1/s1 |
| InChIKey | HABVNGWJOWCDQF-NOZRDPDXSA-N |
| XLogP | 3.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |