C27H30N2O2 — CID 26343798
[(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-[4-(furan-2-yl)phenyl]methanone (PubChem CID 26343798) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is [(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-[4-(furan-2-yl)phenyl]methanone.
| Compound Name | [(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-[4-(furan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 26343798 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | [(4aR,8aS)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-[4-(furan-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccco2)cc1)N1CCC[C@@H]2CN(CCc3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C27H30N2O2/c30-27(23-12-10-22(11-13-23)26-9-5-19-31-26)29-16-4-8-24-20-28(18-15-25(24)29)17-14-21-6-2-1-3-7-21/h1-3,5-7,9-13,19,24-25H,4,8,14-18,20H2/t24-,25+/m1/s1 |
| InChIKey | DFVDCYAFHGBOPU-RPBOFIJWSA-N |
| XLogP | 5.12 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |