C18H23N3O2 — CID 118895801
N-[1-(2-phenylethyl)piperidin-4-yl]furan-2-carbohydrazide (PubChem CID 118895801) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[1-(2-phenylethyl)piperidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N-[1-(2-phenylethyl)piperidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 118895801 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[1-(2-phenylethyl)piperidin-4-yl]furan-2-carbohydrazide |
| SMILES | NN(C(=O)c1ccco1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H23N3O2/c19-21(18(22)17-7-4-14-23-17)16-9-12-20(13-10-16)11-8-15-5-2-1-3-6-15/h1-7,14,16H,8-13,19H2 |
| InChIKey | ZHSKSTRWEFOYHB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|