C26H29N3O4 — CID 11955471
methyl N-[2-[furan-2-carbonyl-[1-(2-phenylethyl)piperidin-4-yl]amino]phenyl]carbamate (PubChem CID 11955471) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is methyl N-[2-[furan-2-carbonyl-[1-(2-phenylethyl)piperidin-4-yl]amino]phenyl]carbamate.
| Compound Name | methyl N-[2-[furan-2-carbonyl-[1-(2-phenylethyl)piperidin-4-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 11955471 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | methyl N-[2-[furan-2-carbonyl-[1-(2-phenylethyl)piperidin-4-yl]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccccc1N(C(=O)c1ccco1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O4/c1-32-26(31)27-22-10-5-6-11-23(22)29(25(30)24-12-7-19-33-24)21-14-17-28(18-15-21)16-13-20-8-3-2-4-9-20/h2-12,19,21H,13-18H2,1H3,(H,27,31) |
| InChIKey | SHMINLSCJYCUON-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |