C29H33N3O7 — CID 11620778
N-(3-acetamidophenyl)-N-[(3R,4S)-3-methyl-1-(2-phenylethyl)piperidin-4-yl]furan-2-carboxamide;oxalic acid (PubChem CID 11620778) has the molecular formula C29H33N3O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-N-[(3R,4S)-3-methyl-1-(2-phenylethyl)piperidin-4-yl]furan-2-carboxamide;oxalic acid.
| Compound Name | N-(3-acetamidophenyl)-N-[(3R,4S)-3-methyl-1-(2-phenylethyl)piperidin-4-yl]furan-2-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 11620778 |
| Molecular Formula | C29H33N3O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-(3-acetamidophenyl)-N-[(3R,4S)-3-methyl-1-(2-phenylethyl)piperidin-4-yl]furan-2-carboxamide;oxalic acid |
| SMILES | CC(=O)Nc1cccc(N(C(=O)c2ccco2)[C@H]2CCN(CCc3ccccc3)C[C@H]2C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H31N3O3.C2H2O4/c1-20-19-29(15-13-22-8-4-3-5-9-22)16-14-25(20)30(27(32)26-12-7-17-33-26)24-11-6-10-23(18-24)28-21(2)31;3-1(4)2(5)6/h3-12,17-18,20,25H,13-16,19H2,1-2H3,(H,28,31);(H,3,4)(H,5,6)/t20-,25+;/m1./s1 |
| InChIKey | MTUFBMOBLCDUFB-NLEDUAFPSA-N |
| XLogP | 3.99 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|