C33H35N3O4 — CID 68957737
benzyl 3-[(3S,4R)-4-[3-amino-N-(furan-2-carbonyl)anilino]-3-methylpiperidin-1-yl]-2-phenylpropanoate (PubChem CID 68957737) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is benzyl 3-[(3S,4R)-4-[3-amino-N-(furan-2-carbonyl)anilino]-3-methylpiperidin-1-yl]-2-phenylpropanoate.
| Compound Name | benzyl 3-[(3S,4R)-4-[3-amino-N-(furan-2-carbonyl)anilino]-3-methylpiperidin-1-yl]-2-phenylpropanoate |
|---|---|
| PubChem CID | 68957737 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | benzyl 3-[(3S,4R)-4-[3-amino-N-(furan-2-carbonyl)anilino]-3-methylpiperidin-1-yl]-2-phenylpropanoate |
| SMILES | C[C@H]1CN(CC(C(=O)OCc2ccccc2)c2ccccc2)CC[C@H]1N(C(=O)c1ccco1)c1cccc(N)c1 |
| InChI | InChI=1S/C33H35N3O4/c1-24-21-35(22-29(26-12-6-3-7-13-26)33(38)40-23-25-10-4-2-5-11-25)18-17-30(24)36(28-15-8-14-27(34)20-28)32(37)31-16-9-19-39-31/h2-16,19-20,24,29-30H,17-18,21-23,34H2,1H3/t24-,29?,30+/m0/s1 |
| InChIKey | NKRCJAQZKLZDHI-DHSZNAABSA-N |
| XLogP | 5.75 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|