C32H37N3O5 — CID 68960301
methyl 4-(3-amino-N-propanoylanilino)-1-(3-oxo-2-phenyl-3-phenylmethoxypropyl)piperidine-4-carboxylate (PubChem CID 68960301) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is methyl 4-(3-amino-N-propanoylanilino)-1-(3-oxo-2-phenyl-3-phenylmethoxypropyl)piperidine-4-carboxylate.
| Compound Name | methyl 4-(3-amino-N-propanoylanilino)-1-(3-oxo-2-phenyl-3-phenylmethoxypropyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 68960301 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | methyl 4-(3-amino-N-propanoylanilino)-1-(3-oxo-2-phenyl-3-phenylmethoxypropyl)piperidine-4-carboxylate |
| SMILES | CCC(=O)N(c1cccc(N)c1)C1(C(=O)OC)CCN(CC(C(=O)OCc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H37N3O5/c1-3-29(36)35(27-16-10-15-26(33)21-27)32(31(38)39-2)17-19-34(20-18-32)22-28(25-13-8-5-9-14-25)30(37)40-23-24-11-6-4-7-12-24/h4-16,21,28H,3,17-20,22-23,33H2,1-2H3 |
| InChIKey | DYRUNOFLBQIOBN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|