C28H32N2O3 — CID 102014816
methyl 1-(2-naphthalen-2-ylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate (PubChem CID 102014816) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is methyl 1-(2-naphthalen-2-ylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate.
| Compound Name | methyl 1-(2-naphthalen-2-ylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 102014816 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | methyl 1-(2-naphthalen-2-ylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C28H32N2O3/c1-3-26(31)30(25-11-5-4-6-12-25)28(27(32)33-2)16-19-29(20-17-28)18-15-22-13-14-23-9-7-8-10-24(23)21-22/h4-14,21H,3,15-20H2,1-2H3 |
| InChIKey | YOYOOJLUDFLQHY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |