C24H34N2O7 — CID 53341592
methyl 1-(3-methoxy-3-oxopropyl)-4-(N-propanoylanilino)piperidine-4-carboxylate;2-methylprop-2-enoic acid (PubChem CID 53341592) has the molecular formula C24H34N2O7 and a molecular weight of 462.54 g/mol. Its IUPAC name is methyl 1-(3-methoxy-3-oxopropyl)-4-(N-propanoylanilino)piperidine-4-carboxylate;2-methylprop-2-enoic acid.
| Compound Name | methyl 1-(3-methoxy-3-oxopropyl)-4-(N-propanoylanilino)piperidine-4-carboxylate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 53341592 |
| Molecular Formula | C24H34N2O7 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | methyl 1-(3-methoxy-3-oxopropyl)-4-(N-propanoylanilino)piperidine-4-carboxylate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCC(=O)OC)CC1 |
| InChI | InChI=1S/C20H28N2O5.C4H6O2/c1-4-17(23)22(16-8-6-5-7-9-16)20(19(25)27-3)11-14-21(15-12-20)13-10-18(24)26-2;1-3(2)4(5)6/h5-9H,4,10-15H2,1-3H3;1H2,2H3,(H,5,6) |
| InChIKey | NWORTIOWUJLIHA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|