C24H30N2O3 — CID 165365203
methyl 1-[2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)ethyl]-4-(N-propanoylanilino)piperidine-4-carboxylate (PubChem CID 165365203) has the molecular formula C24H30N2O3 and a molecular weight of 400.47 g/mol. Its IUPAC name is methyl 1-[2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)ethyl]-4-(N-propanoylanilino)piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)ethyl]-4-(N-propanoylanilino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 165365203 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | methyl 1-[2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)ethyl]-4-(N-propanoylanilino)piperidine-4-carboxylate |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CC[13c]2[13cH][13cH][13cH][13cH][13cH]2)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-3-22(27)26(21-12-8-5-9-13-21)24(23(28)29-2)15-18-25(19-16-24)17-14-20-10-6-4-7-11-20/h4-13H,3,14-19H2,1-2H3/i4+1,6+1,7+1,10+1,11+1,20+1 |
| InChIKey | YDSDEBIZUNNPOB-ZFECAAFISA-N |
| XLogP | 3.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |