C27H34N2O4 — CID 163899623
2-oxobutyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate (PubChem CID 163899623) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-oxobutyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate.
| Compound Name | 2-oxobutyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 163899623 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 2-oxobutyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
| SMILES | CCC(=O)COC(=O)C1(N(C(=O)CC)c2ccccc2)CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H34N2O4/c1-3-24(30)21-33-26(32)27(29(25(31)4-2)23-13-9-6-10-14-23)16-19-28(20-17-27)18-15-22-11-7-5-8-12-22/h5-14H,3-4,15-21H2,1-2H3 |
| InChIKey | QIRGUYREJHVXNC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |