C40H57ClN4O10 — CID 68755108
bis(methyl 1-(3-methoxy-3-oxopropyl)-4-(N-propanoylanilino)piperidine-4-carboxylate);hydrochloride (PubChem CID 68755108) has the molecular formula C40H57ClN4O10 and a molecular weight of 789.37 g/mol. Its IUPAC name is bis(methyl 1-(3-methoxy-3-oxopropyl)-4-(N-propanoylanilino)piperidine-4-carboxylate);hydrochloride.
| Compound Name | bis(methyl 1-(3-methoxy-3-oxopropyl)-4-(N-propanoylanilino)piperidine-4-carboxylate);hydrochloride |
|---|---|
| PubChem CID | 68755108 |
| Molecular Formula | C40H57ClN4O10 |
| Molecular Weight | 789.37 g/mol |
| Exact Mass | 788.38 |
| IUPAC Name | bis(methyl 1-(3-methoxy-3-oxopropyl)-4-(N-propanoylanilino)piperidine-4-carboxylate);hydrochloride |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCC(=O)OC)CC1.CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCC(=O)OC)CC1.Cl |
| InChI | InChI=1S/2C20H28N2O5.ClH/c2*1-4-17(23)22(16-8-6-5-7-9-16)20(19(25)27-3)11-14-21(15-12-20)13-10-18(24)26-2;/h2*5-9H,4,10-15H2,1-3H3;1H |
| InChIKey | CAHCPPICYIOSRD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 152.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|