C24H31N2NaO3 — CID 173002379
sodium;hydride;methyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate (PubChem CID 173002379) has the molecular formula C24H31N2NaO3 and a molecular weight of 418.51 g/mol. Its IUPAC name is sodium;hydride;methyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate.
| Compound Name | sodium;hydride;methyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 173002379 |
| Molecular Formula | C24H31N2NaO3 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | sodium;hydride;methyl 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCc2ccccc2)CC1.[H-].[Na+] |
| InChI | InChI=1S/C24H30N2O3.Na.H/c1-3-22(27)26(21-12-8-5-9-13-21)24(23(28)29-2)15-18-25(19-16-24)17-14-20-10-6-4-7-11-20;;/h4-13H,3,14-19H2,1-2H3;;/q;+1;-1 |
| InChIKey | PRIZATGDJAOTLY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |