C34H48N2O5 — CID 163569430
(7-butoxy-4-oxoheptyl) 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate (PubChem CID 163569430) has the molecular formula C34H48N2O5 and a molecular weight of 564.77 g/mol. Its IUPAC name is (7-butoxy-4-oxoheptyl) 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate.
| Compound Name | (7-butoxy-4-oxoheptyl) 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 163569430 |
| Molecular Formula | C34H48N2O5 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | (7-butoxy-4-oxoheptyl) 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
| SMILES | CCCCOCCCC(=O)CCCOC(=O)C1(N(C(=O)CC)c2ccccc2)CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C34H48N2O5/c1-3-5-26-40-27-12-18-31(37)19-13-28-41-33(39)34(36(32(38)4-2)30-16-10-7-11-17-30)21-24-35(25-22-34)23-20-29-14-8-6-9-15-29/h6-11,14-17H,3-5,12-13,18-28H2,1-2H3 |
| InChIKey | FXZTXDGQRPEDRA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|