C27H36N2O2Y-2 — CID 153116157
2-methylpropane;N-[4-(oxomethyl)-1-(2-phenylethyl)piperidin-4-yl]-N-phenylpropanamide;yttrium (PubChem CID 153116157) has the molecular formula C27H36N2O2Y-2 and a molecular weight of 509.50 g/mol. Its IUPAC name is 2-methylpropane;N-[4-(oxomethyl)-1-(2-phenylethyl)piperidin-4-yl]-N-phenylpropanamide;yttrium.
| Compound Name | 2-methylpropane;N-[4-(oxomethyl)-1-(2-phenylethyl)piperidin-4-yl]-N-phenylpropanamide;yttrium |
|---|---|
| PubChem CID | 153116157 |
| Molecular Formula | C27H36N2O2Y-2 |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 2-methylpropane;N-[4-(oxomethyl)-1-(2-phenylethyl)piperidin-4-yl]-N-phenylpropanamide;yttrium |
| SMILES | CCC(=O)N(c1ccccc1)C1([C-]=O)CCN(CCc2ccccc2)CC1.C[C-](C)C.[Y] |
| InChI | InChI=1S/C23H27N2O2.C4H9.Y/c1-2-22(27)25(21-11-7-4-8-12-21)23(19-26)14-17-24(18-15-23)16-13-20-9-5-3-6-10-20;1-4(2)3;/h3-12H,2,13-18H2,1H3;1-3H3;/q2*-1; |
| InChIKey | OIMCRRYNDSHOJK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|