C27H36N2 — CID 153395447
N,4-bis(but-1-en-2-yl)-N-phenyl-1-(2-phenylethyl)piperidin-4-amine (PubChem CID 153395447) has the molecular formula C27H36N2 and a molecular weight of 388.60 g/mol. Its IUPAC name is N,4-bis(but-1-en-2-yl)-N-phenyl-1-(2-phenylethyl)piperidin-4-amine.
| Compound Name | N,4-bis(but-1-en-2-yl)-N-phenyl-1-(2-phenylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 153395447 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | N,4-bis(but-1-en-2-yl)-N-phenyl-1-(2-phenylethyl)piperidin-4-amine |
| SMILES | C=C(CC)N(c1ccccc1)C1(C(=C)CC)CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H36N2/c1-5-23(3)27(29(24(4)6-2)26-15-11-8-12-16-26)18-21-28(22-19-27)20-17-25-13-9-7-10-14-25/h7-16H,3-6,17-22H2,1-2H3 |
| InChIKey | GKHWNEOKWMBLFD-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|