C24H28N2O3 — CID 10834364
methyl (E)-4-oxo-4-(N-[1-(2-phenylethyl)piperidin-4-yl]anilino)but-2-enoate (PubChem CID 10834364) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl (E)-4-oxo-4-(N-[1-(2-phenylethyl)piperidin-4-yl]anilino)but-2-enoate.
| Compound Name | methyl (E)-4-oxo-4-(N-[1-(2-phenylethyl)piperidin-4-yl]anilino)but-2-enoate |
|---|---|
| PubChem CID | 10834364 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | methyl (E)-4-oxo-4-(N-[1-(2-phenylethyl)piperidin-4-yl]anilino)but-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N2O3/c1-29-24(28)13-12-23(27)26(21-10-6-3-7-11-21)22-15-18-25(19-16-22)17-14-20-8-4-2-5-9-20/h2-13,22H,14-19H2,1H3/b13-12+ |
| InChIKey | PVNYAQCJWIQTRZ-OUKQBFOZSA-N |
| XLogP | 3.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|