C22H27ClN2O — CID 139032969
2-chloro-N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide (PubChem CID 139032969) has the molecular formula C22H27ClN2O and a molecular weight of 370.92 g/mol. Its IUPAC name is 2-chloro-N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide.
| Compound Name | 2-chloro-N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 139032969 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-chloro-N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| SMILES | CC(Cl)C(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27ClN2O/c1-18(23)22(26)25(20-10-6-3-7-11-20)21-13-16-24(17-14-21)15-12-19-8-4-2-5-9-19/h2-11,18,21H,12-17H2,1H3 |
| InChIKey | QWBHMXNWOVMXPX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|