C23H25F3N2O — CID 92585496
1-[(3S,3aS,7aR)-5-[(3,4-difluorophenyl)methyl]-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]propan-1-one (PubChem CID 92585496) has the molecular formula C23H25F3N2O and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-5-[(3,4-difluorophenyl)methyl]-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]propan-1-one.
| Compound Name | 1-[(3S,3aS,7aR)-5-[(3,4-difluorophenyl)methyl]-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 92585496 |
| Molecular Formula | C23H25F3N2O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[(3S,3aS,7aR)-5-[(3,4-difluorophenyl)methyl]-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1C[C@H](c2ccc(F)cc2)[C@H]2CN(Cc3ccc(F)c(F)c3)CC[C@H]21 |
| InChI | InChI=1S/C23H25F3N2O/c1-2-23(29)28-14-18(16-4-6-17(24)7-5-16)19-13-27(10-9-22(19)28)12-15-3-8-20(25)21(26)11-15/h3-8,11,18-19,22H,2,9-10,12-14H2,1H3/t18-,19-,22-/m1/s1 |
| InChIKey | MIRIHABZWAXPGH-WOIUINJBSA-N |
| XLogP | 4.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |