C24H32FN3O2 — CID 92570298
2-[(3S,3aS,7aR)-1-(cyclopropanecarbonyl)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-N-cyclopentylacetamide (PubChem CID 92570298) has the molecular formula C24H32FN3O2 and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[(3S,3aS,7aR)-1-(cyclopropanecarbonyl)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-N-cyclopentylacetamide.
| Compound Name | 2-[(3S,3aS,7aR)-1-(cyclopropanecarbonyl)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 92570298 |
| Molecular Formula | C24H32FN3O2 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 2-[(3S,3aS,7aR)-1-(cyclopropanecarbonyl)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-N-cyclopentylacetamide |
| SMILES | O=C(CN1CC[C@@H]2[C@H](C1)[C@@H](c1ccc(F)cc1)CN2C(=O)C1CC1)NC1CCCC1 |
| InChI | InChI=1S/C24H32FN3O2/c25-18-9-7-16(8-10-18)20-14-28(24(30)17-5-6-17)22-11-12-27(13-21(20)22)15-23(29)26-19-3-1-2-4-19/h7-10,17,19-22H,1-6,11-15H2,(H,26,29)/t20-,21-,22-/m1/s1 |
| InChIKey | AUYQJWDQRUSYRX-YPAWHYETSA-N |
| XLogP | 2.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |