C23H26FN3O — CID 92570492
[(3R,3aR,7aS)-5-(cyclopropylmethyl)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-3-ylmethanone (PubChem CID 92570492) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is [(3R,3aR,7aS)-5-(cyclopropylmethyl)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3R,3aR,7aS)-5-(cyclopropylmethyl)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 92570492 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | [(3R,3aR,7aS)-5-(cyclopropylmethyl)-3-(4-fluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1C[C@@H](c2ccc(F)cc2)[C@@H]2CN(CC3CC3)CC[C@@H]21 |
| InChI | InChI=1S/C23H26FN3O/c24-19-7-5-17(6-8-19)20-15-27(23(28)18-2-1-10-25-12-18)22-9-11-26(14-21(20)22)13-16-3-4-16/h1-2,5-8,10,12,16,20-22H,3-4,9,11,13-15H2/t20-,21-,22-/m0/s1 |
| InChIKey | ZESCLCUFIRMKOA-FKBYEOEOSA-N |
| XLogP | 3.56 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |