C24H24FN5O2 — CID 92567301
[(3R,3aR,7aS)-3-(4-fluorophenyl)-5-(1-methylimidazole-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone (PubChem CID 92567301) has the molecular formula C24H24FN5O2 and a molecular weight of 433.49 g/mol. Its IUPAC name is [(3R,3aR,7aS)-3-(4-fluorophenyl)-5-(1-methylimidazole-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [(3R,3aR,7aS)-3-(4-fluorophenyl)-5-(1-methylimidazole-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 92567301 |
| Molecular Formula | C24H24FN5O2 |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [(3R,3aR,7aS)-3-(4-fluorophenyl)-5-(1-methylimidazole-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-pyridin-4-ylmethanone |
| SMILES | Cn1ccnc1C(=O)N1CC[C@H]2[C@@H](C1)[C@H](c1ccc(F)cc1)CN2C(=O)c1ccncc1 |
| InChI | InChI=1S/C24H24FN5O2/c1-28-13-11-27-22(28)24(32)29-12-8-21-20(14-29)19(16-2-4-18(25)5-3-16)15-30(21)23(31)17-6-9-26-10-7-17/h2-7,9-11,13,19-21H,8,12,14-15H2,1H3/t19-,20-,21-/m0/s1 |
| InChIKey | DOZVUUPSSKBOHQ-ACRUOGEOSA-N |
| XLogP | 2.72 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |