C23H27ClN2O2 — CID 92550019
1-[(3R,3aR,7aS)-5-[(2-chlorophenyl)methyl]-3-(3-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 92550019) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 1-[(3R,3aR,7aS)-5-[(2-chlorophenyl)methyl]-3-(3-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(3R,3aR,7aS)-5-[(2-chlorophenyl)methyl]-3-(3-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 92550019 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-[(3R,3aR,7aS)-5-[(2-chlorophenyl)methyl]-3-(3-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | COc1cccc([C@@H]2CN(C(C)=O)[C@H]3CCN(Cc4ccccc4Cl)C[C@@H]23)c1 |
| InChI | InChI=1S/C23H27ClN2O2/c1-16(27)26-15-20(17-7-5-8-19(12-17)28-2)21-14-25(11-10-23(21)26)13-18-6-3-4-9-22(18)24/h3-9,12,20-21,23H,10-11,13-15H2,1-2H3/t20-,21-,23-/m0/s1 |
| InChIKey | BAUWMWOIPMURGC-FUDKSRODSA-N |
| XLogP | 4.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |