C27H30N2O — CID 92560949
1-[(3R,3aR,7aS)-3-(3-methylphenyl)-5-(naphthalen-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 92560949) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[(3R,3aR,7aS)-3-(3-methylphenyl)-5-(naphthalen-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(3R,3aR,7aS)-3-(3-methylphenyl)-5-(naphthalen-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 92560949 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[(3R,3aR,7aS)-3-(3-methylphenyl)-5-(naphthalen-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H](c2cccc(C)c2)[C@@H]2CN(Cc3cccc4ccccc34)CC[C@@H]21 |
| InChI | InChI=1S/C27H30N2O/c1-19-7-5-10-22(15-19)25-18-29(20(2)30)27-13-14-28(17-26(25)27)16-23-11-6-9-21-8-3-4-12-24(21)23/h3-12,15,25-27H,13-14,16-18H2,1-2H3/t25-,26-,27-/m0/s1 |
| InChIKey | JVYVLRKMELFKGN-QKDODKLFSA-N |
| XLogP | 4.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |