C28H35N3O2 — CID 166328161
1-[3-[1-(4-cyclopentylbenzoyl)pyrrolidin-3-yl]piperidin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 166328161) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-[3-[1-(4-cyclopentylbenzoyl)pyrrolidin-3-yl]piperidin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[3-[1-(4-cyclopentylbenzoyl)pyrrolidin-3-yl]piperidin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 166328161 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-[3-[1-(4-cyclopentylbenzoyl)pyrrolidin-3-yl]piperidin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CCCC(C2CCN(C(=O)c3ccc(C4CCCC4)cc3)C2)C1 |
| InChI | InChI=1S/C28H35N3O2/c32-27(17-21-5-3-14-29-18-21)30-15-4-8-25(19-30)26-13-16-31(20-26)28(33)24-11-9-23(10-12-24)22-6-1-2-7-22/h3,5,9-12,14,18,22,25-26H,1-2,4,6-8,13,15-17,19-20H2 |
| InChIKey | ZIIDKZFCJDOFPH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |