C27H32N4O2 — CID 167855396
1-[3-[1-(3,7-dimethyl-1H-indole-2-carbonyl)azepan-3-yl]azetidin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 167855396) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[3-[1-(3,7-dimethyl-1H-indole-2-carbonyl)azepan-3-yl]azetidin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[3-[1-(3,7-dimethyl-1H-indole-2-carbonyl)azepan-3-yl]azetidin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 167855396 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-[3-[1-(3,7-dimethyl-1H-indole-2-carbonyl)azepan-3-yl]azetidin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | Cc1c(C(=O)N2CCCCC(C3CN(C(=O)Cc4cccnc4)C3)C2)[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C27H32N4O2/c1-18-7-5-10-23-19(2)26(29-25(18)23)27(33)30-12-4-3-9-21(15-30)22-16-31(17-22)24(32)13-20-8-6-11-28-14-20/h5-8,10-11,14,21-22,29H,3-4,9,12-13,15-17H2,1-2H3 |
| InChIKey | GYWKLIAJWWUOEF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|