C30H37N3O2 — CID 141100657
1-benzyl-3-tert-butyl-1-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]urea (PubChem CID 141100657) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 1-benzyl-3-tert-butyl-1-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]urea.
| Compound Name | 1-benzyl-3-tert-butyl-1-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 141100657 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 1-benzyl-3-tert-butyl-1-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]urea |
| SMILES | CC(C)(C)NC(=O)N(Cc1ccccc1)C1CCN(Cc2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C30H37N3O2/c1-30(2,3)31-29(34)33(23-24-10-6-4-7-11-24)26-18-20-32(21-19-26)22-25-14-16-28(17-15-25)35-27-12-8-5-9-13-27/h4-17,26H,18-23H2,1-3H3,(H,31,34) |
| InChIKey | BHOQRDWMVNWRQT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |