C27H39N3O2 — CID 141100619
1-butyl-3-tert-butyl-1-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]urea (PubChem CID 141100619) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-butyl-3-tert-butyl-1-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]urea.
| Compound Name | 1-butyl-3-tert-butyl-1-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 141100619 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 1-butyl-3-tert-butyl-1-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]urea |
| SMILES | CCCCN(C(=O)NC(C)(C)C)C1CCN(Cc2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H39N3O2/c1-5-6-18-30(26(31)28-27(2,3)4)23-16-19-29(20-17-23)21-22-12-14-25(15-13-22)32-24-10-8-7-9-11-24/h7-15,23H,5-6,16-21H2,1-4H3,(H,28,31) |
| InChIKey | WUPTZVDYVVWREN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |