C28H42N4O4S — CID 67037970
4-[butyl(butylcarbamoyl)amino]-1-[[4-[4-[(sulfinoamino)methyl]phenoxy]phenyl]methyl]piperidine (PubChem CID 67037970) has the molecular formula C28H42N4O4S and a molecular weight of 530.74 g/mol. Its IUPAC name is 4-[butyl(butylcarbamoyl)amino]-1-[[4-[4-[(sulfinoamino)methyl]phenoxy]phenyl]methyl]piperidine.
| Compound Name | 4-[butyl(butylcarbamoyl)amino]-1-[[4-[4-[(sulfinoamino)methyl]phenoxy]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 67037970 |
| Molecular Formula | C28H42N4O4S |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 4-[butyl(butylcarbamoyl)amino]-1-[[4-[4-[(sulfinoamino)methyl]phenoxy]phenyl]methyl]piperidine |
| SMILES | CCCCNC(=O)N(CCCC)C1CCN(Cc2ccc(Oc3ccc(CNS(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H42N4O4S/c1-3-5-17-29-28(33)32(18-6-4-2)25-15-19-31(20-16-25)22-24-9-13-27(14-10-24)36-26-11-7-23(8-12-26)21-30-37(34)35/h7-14,25,30H,3-6,15-22H2,1-2H3,(H,29,33)(H,34,35) |
| InChIKey | UTTXADTXRKNOAK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|