C30H43N4O5S- — CID 91400892
4-[cyclohexylmethylcarbamoyl(2-methoxyethyl)amino]-1-[[4-[4-[(sulfinatoamino)methyl]phenoxy]phenyl]methyl]piperidine (PubChem CID 91400892) has the molecular formula C30H43N4O5S- and a molecular weight of 571.76 g/mol. Its IUPAC name is 4-[cyclohexylmethylcarbamoyl(2-methoxyethyl)amino]-1-[[4-[4-[(sulfinatoamino)methyl]phenoxy]phenyl]methyl]piperidine.
| Compound Name | 4-[cyclohexylmethylcarbamoyl(2-methoxyethyl)amino]-1-[[4-[4-[(sulfinatoamino)methyl]phenoxy]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 91400892 |
| Molecular Formula | C30H43N4O5S- |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 4-[cyclohexylmethylcarbamoyl(2-methoxyethyl)amino]-1-[[4-[4-[(sulfinatoamino)methyl]phenoxy]phenyl]methyl]piperidine |
| SMILES | COCCN(C(=O)NCC1CCCCC1)C1CCN(Cc2ccc(Oc3ccc(CNS(=O)[O-])cc3)cc2)CC1 |
| InChI | InChI=1S/C30H44N4O5S/c1-38-20-19-34(30(35)31-21-24-5-3-2-4-6-24)27-15-17-33(18-16-27)23-26-9-13-29(14-10-26)39-28-11-7-25(8-12-28)22-32-40(36)37/h7-14,24,27,32H,2-6,15-23H2,1H3,(H,31,35)(H,36,37)/p-1 |
| InChIKey | NGTDJIKTTYKBBE-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|