C23H37N3O — CID 141100611
1-(1-benzylpiperidin-4-yl)-3-(cyclohexylmethyl)-1-propylurea (PubChem CID 141100611) has the molecular formula C23H37N3O and a molecular weight of 371.57 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(cyclohexylmethyl)-1-propylurea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(cyclohexylmethyl)-1-propylurea |
|---|---|
| PubChem CID | 141100611 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(cyclohexylmethyl)-1-propylurea |
| SMILES | CCCN(C(=O)NCC1CCCCC1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H37N3O/c1-2-15-26(23(27)24-18-20-9-5-3-6-10-20)22-13-16-25(17-14-22)19-21-11-7-4-8-12-21/h4,7-8,11-12,20,22H,2-3,5-6,9-10,13-19H2,1H3,(H,24,27) |
| InChIKey | HIVHYQSXIVKKSM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |