C34H45ClN4O3S2 — CID 87408037
1-benzyl-3-(cyclohexylmethyl)-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]thiourea;hydrochloride (PubChem CID 87408037) has the molecular formula C34H45ClN4O3S2 and a molecular weight of 657.35 g/mol. Its IUPAC name is 1-benzyl-3-(cyclohexylmethyl)-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]thiourea;hydrochloride.
| Compound Name | 1-benzyl-3-(cyclohexylmethyl)-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 87408037 |
| Molecular Formula | C34H45ClN4O3S2 |
| Molecular Weight | 657.35 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 1-benzyl-3-(cyclohexylmethyl)-1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]thiourea;hydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2ccc(CN3CCC(N(Cc4ccccc4)C(=S)NCC4CCCCC4)CC3)cc2)cc1.Cl |
| InChI | InChI=1S/C34H44N4O3S2.ClH/c1-43(39,40)36-30-14-18-33(19-15-30)41-32-16-12-29(13-17-32)25-37-22-20-31(21-23-37)38(26-28-10-6-3-7-11-28)34(42)35-24-27-8-4-2-5-9-27;/h3,6-7,10-19,27,31,36H,2,4-5,8-9,20-26H2,1H3,(H,35,42);1H |
| InChIKey | XJCPCQAGHYWIOG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.35 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|