C31H36ClN3O5S — CID 141226473
[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-(5-phenylpent-2-ynyl)carbamic acid;hydrochloride (PubChem CID 141226473) has the molecular formula C31H36ClN3O5S and a molecular weight of 598.17 g/mol. Its IUPAC name is [1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-(5-phenylpent-2-ynyl)carbamic acid;hydrochloride.
| Compound Name | [1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-(5-phenylpent-2-ynyl)carbamic acid;hydrochloride |
|---|---|
| PubChem CID | 141226473 |
| Molecular Formula | C31H36ClN3O5S |
| Molecular Weight | 598.17 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | [1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-(5-phenylpent-2-ynyl)carbamic acid;hydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2ccc(CN3CCC(N(CC#CCCc4ccccc4)C(=O)O)CC3)cc2)cc1.Cl |
| InChI | InChI=1S/C31H35N3O5S.ClH/c1-40(37,38)32-27-13-17-30(18-14-27)39-29-15-11-26(12-16-29)24-33-22-19-28(20-23-33)34(31(35)36)21-7-3-6-10-25-8-4-2-5-9-25;/h2,4-5,8-9,11-18,28,32H,6,10,19-24H2,1H3,(H,35,36);1H |
| InChIKey | CUHIGNKNYOTYSQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.17 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|