C31H46N4O4S — CID 67038776
4-[butylcarbamoyl(cyclohexylmethyl)amino]-1-[[4-[4-[(sulfinoamino)methyl]phenoxy]phenyl]methyl]piperidine (PubChem CID 67038776) has the molecular formula C31H46N4O4S and a molecular weight of 570.80 g/mol. Its IUPAC name is 4-[butylcarbamoyl(cyclohexylmethyl)amino]-1-[[4-[4-[(sulfinoamino)methyl]phenoxy]phenyl]methyl]piperidine.
| Compound Name | 4-[butylcarbamoyl(cyclohexylmethyl)amino]-1-[[4-[4-[(sulfinoamino)methyl]phenoxy]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 67038776 |
| Molecular Formula | C31H46N4O4S |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | 4-[butylcarbamoyl(cyclohexylmethyl)amino]-1-[[4-[4-[(sulfinoamino)methyl]phenoxy]phenyl]methyl]piperidine |
| SMILES | CCCCNC(=O)N(CC1CCCCC1)C1CCN(Cc2ccc(Oc3ccc(CNS(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H46N4O4S/c1-2-3-19-32-31(36)35(24-26-7-5-4-6-8-26)28-17-20-34(21-18-28)23-27-11-15-30(16-12-27)39-29-13-9-25(10-14-29)22-33-40(37)38/h9-16,26,28,33H,2-8,17-24H2,1H3,(H,32,36)(H,37,38) |
| InChIKey | DWMCTIOXZSWBDQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|