C31H41N5O6S2 — CID 67037858
4-[butyl-[[3-[(sulfinoamino)methyl]phenyl]carbamoyl]amino]-1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidine (PubChem CID 67037858) has the molecular formula C31H41N5O6S2 and a molecular weight of 643.83 g/mol. Its IUPAC name is 4-[butyl-[[3-[(sulfinoamino)methyl]phenyl]carbamoyl]amino]-1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidine.
| Compound Name | 4-[butyl-[[3-[(sulfinoamino)methyl]phenyl]carbamoyl]amino]-1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 67037858 |
| Molecular Formula | C31H41N5O6S2 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | 4-[butyl-[[3-[(sulfinoamino)methyl]phenyl]carbamoyl]amino]-1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidine |
| SMILES | CCCCN(C(=O)Nc1cccc(CNS(=O)O)c1)C1CCN(Cc2ccc(Oc3ccc(NS(C)(=O)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H41N5O6S2/c1-3-4-18-36(31(37)33-27-7-5-6-25(21-27)22-32-43(38)39)28-16-19-35(20-17-28)23-24-8-12-29(13-9-24)42-30-14-10-26(11-15-30)34-44(2,40)41/h5-15,21,28,32,34H,3-4,16-20,22-23H2,1-2H3,(H,33,37)(H,38,39) |
| InChIKey | PDCAQVAGAQTLCO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|